C16H19FN2O2 — CID 75485085
[4-(6-fluoro-2,3-dimethylquinolin-4-yl)morpholin-2-yl]methanol (PubChem CID 75485085) has the molecular formula C16H19FN2O2 and a molecular weight of 290.34 g/mol. Its IUPAC name is [4-(6-fluoro-2,3-dimethylquinolin-4-yl)morpholin-2-yl]methanol.
| Compound Name | [4-(6-fluoro-2,3-dimethylquinolin-4-yl)morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 75485085 |
| Molecular Formula | C16H19FN2O2 |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | [4-(6-fluoro-2,3-dimethylquinolin-4-yl)morpholin-2-yl]methanol |
| SMILES | Cc1nc2ccc(F)cc2c(N2CCOC(CO)C2)c1C |
| InChI | InChI=1S/C16H19FN2O2/c1-10-11(2)18-15-4-3-12(17)7-14(15)16(10)19-5-6-21-13(8-19)9-20/h3-4,7,13,20H,5-6,8-9H2,1-2H3 |
| InChIKey | OZBRTBOADXQZGE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |