C22H24N2O2 — CID 133438456
3-[4-(3-ethyl-2-methylquinolin-4-yl)morpholin-2-yl]phenol (PubChem CID 133438456) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 3-[4-(3-ethyl-2-methylquinolin-4-yl)morpholin-2-yl]phenol.
| Compound Name | 3-[4-(3-ethyl-2-methylquinolin-4-yl)morpholin-2-yl]phenol |
|---|---|
| PubChem CID | 133438456 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 3-[4-(3-ethyl-2-methylquinolin-4-yl)morpholin-2-yl]phenol |
| SMILES | CCc1c(C)nc2ccccc2c1N1CCOC(c2cccc(O)c2)C1 |
| InChI | InChI=1S/C22H24N2O2/c1-3-18-15(2)23-20-10-5-4-9-19(20)22(18)24-11-12-26-21(14-24)16-7-6-8-17(25)13-16/h4-10,13,21,25H,3,11-12,14H2,1-2H3 |
| InChIKey | IYZXQCFMRDXORZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |