C16H18N2O5 — CID 133438604
[3-[2-(5-methylfuran-2-yl)morpholin-4-yl]-4-nitrophenyl]methanol (PubChem CID 133438604) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is [3-[2-(5-methylfuran-2-yl)morpholin-4-yl]-4-nitrophenyl]methanol.
| Compound Name | [3-[2-(5-methylfuran-2-yl)morpholin-4-yl]-4-nitrophenyl]methanol |
|---|---|
| PubChem CID | 133438604 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | [3-[2-(5-methylfuran-2-yl)morpholin-4-yl]-4-nitrophenyl]methanol |
| SMILES | Cc1ccc(C2CN(c3cc(CO)ccc3[N+](=O)[O-])CCO2)o1 |
| InChI | InChI=1S/C16H18N2O5/c1-11-2-5-15(23-11)16-9-17(6-7-22-16)14-8-12(10-19)3-4-13(14)18(20)21/h2-5,8,16,19H,6-7,9-10H2,1H3 |
| InChIKey | NCDYEYGTYJLJLA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 88.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|