C17H19N3O5 — CID 97071302
(2R)-2-(5-methylfuran-2-yl)-N-[(3-nitrophenyl)methyl]morpholine-4-carboxamide (PubChem CID 97071302) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is (2R)-2-(5-methylfuran-2-yl)-N-[(3-nitrophenyl)methyl]morpholine-4-carboxamide.
| Compound Name | (2R)-2-(5-methylfuran-2-yl)-N-[(3-nitrophenyl)methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 97071302 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (2R)-2-(5-methylfuran-2-yl)-N-[(3-nitrophenyl)methyl]morpholine-4-carboxamide |
| SMILES | Cc1ccc([C@H]2CN(C(=O)NCc3cccc([N+](=O)[O-])c3)CCO2)o1 |
| InChI | InChI=1S/C17H19N3O5/c1-12-5-6-15(25-12)16-11-19(7-8-24-16)17(21)18-10-13-3-2-4-14(9-13)20(22)23/h2-6,9,16H,7-8,10-11H2,1H3,(H,18,21)/t16-/m1/s1 |
| InChIKey | KAOHHWXMKSDIKK-MRXNPFEDSA-N |
| XLogP | 2.78 |
| TPSA | 97.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|