C17H20N2O4S — CID 97242640
(2R)-2-(5-methylfuran-2-yl)-N-[3-[(R)-methylsulfinyl]phenyl]morpholine-4-carboxamide (PubChem CID 97242640) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is (2R)-2-(5-methylfuran-2-yl)-N-[3-[(R)-methylsulfinyl]phenyl]morpholine-4-carboxamide.
| Compound Name | (2R)-2-(5-methylfuran-2-yl)-N-[3-[(R)-methylsulfinyl]phenyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 97242640 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (2R)-2-(5-methylfuran-2-yl)-N-[3-[(R)-methylsulfinyl]phenyl]morpholine-4-carboxamide |
| SMILES | Cc1ccc([C@H]2CN(C(=O)Nc3cccc([S@@](C)=O)c3)CCO2)o1 |
| InChI | InChI=1S/C17H20N2O4S/c1-12-6-7-15(23-12)16-11-19(8-9-22-16)17(20)18-13-4-3-5-14(10-13)24(2)21/h3-7,10,16H,8-9,11H2,1-2H3,(H,18,20)/t16-,24-/m1/s1 |
| InChIKey | HODORRKQVRITFN-VOIUYBSRSA-N |
| XLogP | 2.93 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |