C16H16F2N2O3 — CID 99601315
(2S)-N-[3-(difluoromethyl)phenyl]-2-(furan-2-yl)morpholine-4-carboxamide (PubChem CID 99601315) has the molecular formula C16H16F2N2O3 and a molecular weight of 322.31 g/mol. Its IUPAC name is (2S)-N-[3-(difluoromethyl)phenyl]-2-(furan-2-yl)morpholine-4-carboxamide.
| Compound Name | (2S)-N-[3-(difluoromethyl)phenyl]-2-(furan-2-yl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 99601315 |
| Molecular Formula | C16H16F2N2O3 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (2S)-N-[3-(difluoromethyl)phenyl]-2-(furan-2-yl)morpholine-4-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)F)c1)N1CCO[C@H](c2ccco2)C1 |
| InChI | InChI=1S/C16H16F2N2O3/c17-15(18)11-3-1-4-12(9-11)19-16(21)20-6-8-23-14(10-20)13-5-2-7-22-13/h1-5,7,9,14-15H,6,8,10H2,(H,19,21)/t14-/m0/s1 |
| InChIKey | LTLYXNVZRNEUFN-AWEZNQCLSA-N |
| XLogP | 3.82 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |