C18H17ClN4O3 — CID 126792095
N-(3-chloro-4-pyrazol-1-ylphenyl)-2-(furan-2-yl)morpholine-4-carboxamide (PubChem CID 126792095) has the molecular formula C18H17ClN4O3 and a molecular weight of 372.81 g/mol. Its IUPAC name is N-(3-chloro-4-pyrazol-1-ylphenyl)-2-(furan-2-yl)morpholine-4-carboxamide.
| Compound Name | N-(3-chloro-4-pyrazol-1-ylphenyl)-2-(furan-2-yl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 126792095 |
| Molecular Formula | C18H17ClN4O3 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-(3-chloro-4-pyrazol-1-ylphenyl)-2-(furan-2-yl)morpholine-4-carboxamide |
| SMILES | O=C(Nc1ccc(-n2cccn2)c(Cl)c1)N1CCOC(c2ccco2)C1 |
| InChI | InChI=1S/C18H17ClN4O3/c19-14-11-13(4-5-15(14)23-7-2-6-20-23)21-18(24)22-8-10-26-17(12-22)16-3-1-9-25-16/h1-7,9,11,17H,8,10,12H2,(H,21,24) |
| InChIKey | QQKYYBBWSCXFLZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |