C16H16ClFN2O3 — CID 124619649
(2R)-N-[(4-chloro-2-fluorophenyl)methyl]-2-(furan-2-yl)morpholine-4-carboxamide (PubChem CID 124619649) has the molecular formula C16H16ClFN2O3 and a molecular weight of 338.77 g/mol. Its IUPAC name is (2R)-N-[(4-chloro-2-fluorophenyl)methyl]-2-(furan-2-yl)morpholine-4-carboxamide.
| Compound Name | (2R)-N-[(4-chloro-2-fluorophenyl)methyl]-2-(furan-2-yl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 124619649 |
| Molecular Formula | C16H16ClFN2O3 |
| Molecular Weight | 338.77 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (2R)-N-[(4-chloro-2-fluorophenyl)methyl]-2-(furan-2-yl)morpholine-4-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1F)N1CCO[C@@H](c2ccco2)C1 |
| InChI | InChI=1S/C16H16ClFN2O3/c17-12-4-3-11(13(18)8-12)9-19-16(21)20-5-7-23-15(10-20)14-2-1-6-22-14/h1-4,6,8,15H,5,7,9-10H2,(H,19,21)/t15-/m1/s1 |
| InChIKey | PKPFEQHBIZAULA-OAHLLOKOSA-N |
| XLogP | 3.36 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.77 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |