C21H19ClF4N4O4 — CID 134584149
2-(3-chlorophenyl)-N-[[2-fluoro-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]morpholine-4-carboxamide (PubChem CID 134584149) has the molecular formula C21H19ClF4N4O4 and a molecular weight of 502.85 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[[2-fluoro-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]morpholine-4-carboxamide.
| Compound Name | 2-(3-chlorophenyl)-N-[[2-fluoro-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 134584149 |
| Molecular Formula | C21H19ClF4N4O4 |
| Molecular Weight | 502.85 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[[2-fluoro-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]morpholine-4-carboxamide |
| SMILES | O=C(NNC(=O)C(F)(F)F)c1ccc(CNC(=O)N2CCOC(c3cccc(Cl)c3)C2)c(F)c1 |
| InChI | InChI=1S/C21H19ClF4N4O4/c22-15-3-1-2-12(8-15)17-11-30(6-7-34-17)20(33)27-10-14-5-4-13(9-16(14)23)18(31)28-29-19(32)21(24,25)26/h1-5,8-9,17H,6-7,10-11H2,(H,27,33)(H,28,31)(H,29,32) |
| InChIKey | GYUQNWVDRSAKLC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.85 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|