C19H17ClFN3O2 — CID 102555839
2-(3-chloro-4-fluorophenyl)-N-[(3-cyanophenyl)methyl]morpholine-4-carboxamide (PubChem CID 102555839) has the molecular formula C19H17ClFN3O2 and a molecular weight of 373.82 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-N-[(3-cyanophenyl)methyl]morpholine-4-carboxamide.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-N-[(3-cyanophenyl)methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 102555839 |
| Molecular Formula | C19H17ClFN3O2 |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-N-[(3-cyanophenyl)methyl]morpholine-4-carboxamide |
| SMILES | N#Cc1cccc(CNC(=O)N2CCOC(c3ccc(F)c(Cl)c3)C2)c1 |
| InChI | InChI=1S/C19H17ClFN3O2/c20-16-9-15(4-5-17(16)21)18-12-24(6-7-26-18)19(25)23-11-14-3-1-2-13(8-14)10-22/h1-5,8-9,18H,6-7,11-12H2,(H,23,25) |
| InChIKey | IEAPXMRATWBVEH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |