C18H22FN3O2 — CID 97249747
(2S)-2-(4-fluoro-3-methylphenyl)-N-[(1-methylpyrrol-3-yl)methyl]morpholine-4-carboxamide (PubChem CID 97249747) has the molecular formula C18H22FN3O2 and a molecular weight of 331.39 g/mol. Its IUPAC name is (2S)-2-(4-fluoro-3-methylphenyl)-N-[(1-methylpyrrol-3-yl)methyl]morpholine-4-carboxamide.
| Compound Name | (2S)-2-(4-fluoro-3-methylphenyl)-N-[(1-methylpyrrol-3-yl)methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 97249747 |
| Molecular Formula | C18H22FN3O2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | (2S)-2-(4-fluoro-3-methylphenyl)-N-[(1-methylpyrrol-3-yl)methyl]morpholine-4-carboxamide |
| SMILES | Cc1cc([C@H]2CN(C(=O)NCc3ccn(C)c3)CCO2)ccc1F |
| InChI | InChI=1S/C18H22FN3O2/c1-13-9-15(3-4-16(13)19)17-12-22(7-8-24-17)18(23)20-10-14-5-6-21(2)11-14/h3-6,9,11,17H,7-8,10,12H2,1-2H3,(H,20,23)/t17-/m1/s1 |
| InChIKey | WZIQDIMZDVHSIE-QGZVFWFLSA-N |
| XLogP | 2.76 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |