C18H18FNO3S — CID 75395432
1-[5-[2-(4-fluoro-3-methylphenyl)morpholine-4-carbonyl]thiophen-3-yl]ethanone (PubChem CID 75395432) has the molecular formula C18H18FNO3S and a molecular weight of 347.41 g/mol. Its IUPAC name is 1-[5-[2-(4-fluoro-3-methylphenyl)morpholine-4-carbonyl]thiophen-3-yl]ethanone.
| Compound Name | 1-[5-[2-(4-fluoro-3-methylphenyl)morpholine-4-carbonyl]thiophen-3-yl]ethanone |
|---|---|
| PubChem CID | 75395432 |
| Molecular Formula | C18H18FNO3S |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 1-[5-[2-(4-fluoro-3-methylphenyl)morpholine-4-carbonyl]thiophen-3-yl]ethanone |
| SMILES | CC(=O)c1csc(C(=O)N2CCOC(c3ccc(F)c(C)c3)C2)c1 |
| InChI | InChI=1S/C18H18FNO3S/c1-11-7-13(3-4-15(11)19)16-9-20(5-6-23-16)18(22)17-8-14(10-24-17)12(2)21/h3-4,7-8,10,16H,5-6,9H2,1-2H3 |
| InChIKey | RHUAWFSZHNMWNK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |