C22H22F4N4O4 — CID 134584535
2-(2-fluoro-4-methylphenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]morpholine-4-carboxamide (PubChem CID 134584535) has the molecular formula C22H22F4N4O4 and a molecular weight of 482.43 g/mol. Its IUPAC name is 2-(2-fluoro-4-methylphenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]morpholine-4-carboxamide.
| Compound Name | 2-(2-fluoro-4-methylphenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 134584535 |
| Molecular Formula | C22H22F4N4O4 |
| Molecular Weight | 482.43 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 2-(2-fluoro-4-methylphenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]morpholine-4-carboxamide |
| SMILES | Cc1ccc(C2CN(C(=O)NCc3ccc(C(=O)NNC(=O)C(F)(F)F)cc3)CCO2)c(F)c1 |
| InChI | InChI=1S/C22H22F4N4O4/c1-13-2-7-16(17(23)10-13)18-12-30(8-9-34-18)21(33)27-11-14-3-5-15(6-4-14)19(31)28-29-20(32)22(24,25)26/h2-7,10,18H,8-9,11-12H2,1H3,(H,27,33)(H,28,31)(H,29,32) |
| InChIKey | JPRYANHUSWOWJX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|