C14H15ClN2O3 — CID 124609210
(4-chloro-1-methylpyrrol-2-yl)-[(2S)-2-(furan-2-yl)morpholin-4-yl]methanone (PubChem CID 124609210) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is (4-chloro-1-methylpyrrol-2-yl)-[(2S)-2-(furan-2-yl)morpholin-4-yl]methanone.
| Compound Name | (4-chloro-1-methylpyrrol-2-yl)-[(2S)-2-(furan-2-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 124609210 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (4-chloro-1-methylpyrrol-2-yl)-[(2S)-2-(furan-2-yl)morpholin-4-yl]methanone |
| SMILES | Cn1cc(Cl)cc1C(=O)N1CCO[C@H](c2ccco2)C1 |
| InChI | InChI=1S/C14H15ClN2O3/c1-16-8-10(15)7-11(16)14(18)17-4-6-20-13(9-17)12-3-2-5-19-12/h2-3,5,7-8,13H,4,6,9H2,1H3/t13-/m0/s1 |
| InChIKey | NSIGKNPUOAXNQM-ZDUSSCGKSA-N |
| XLogP | 2.49 |
| TPSA | 47.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |