C16H16BrClN2O2 — CID 87011263
(4-bromo-1-methylpyrrol-2-yl)-[2-(4-chlorophenyl)morpholin-4-yl]methanone (PubChem CID 87011263) has the molecular formula C16H16BrClN2O2 and a molecular weight of 383.67 g/mol. Its IUPAC name is (4-bromo-1-methylpyrrol-2-yl)-[2-(4-chlorophenyl)morpholin-4-yl]methanone.
| Compound Name | (4-bromo-1-methylpyrrol-2-yl)-[2-(4-chlorophenyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 87011263 |
| Molecular Formula | C16H16BrClN2O2 |
| Molecular Weight | 383.67 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | (4-bromo-1-methylpyrrol-2-yl)-[2-(4-chlorophenyl)morpholin-4-yl]methanone |
| SMILES | Cn1cc(Br)cc1C(=O)N1CCOC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H16BrClN2O2/c1-19-9-12(17)8-14(19)16(21)20-6-7-22-15(10-20)11-2-4-13(18)5-3-11/h2-5,8-9,15H,6-7,10H2,1H3 |
| InChIKey | ZEFMXQFJJIIYIX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.67 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |