C17H18ClN3O4 — CID 95217867
methyl 5-[(2R)-2-(4-chlorophenyl)morpholine-4-carbonyl]-1-methylpyrazole-3-carboxylate (PubChem CID 95217867) has the molecular formula C17H18ClN3O4 and a molecular weight of 363.80 g/mol. Its IUPAC name is methyl 5-[(2R)-2-(4-chlorophenyl)morpholine-4-carbonyl]-1-methylpyrazole-3-carboxylate.
| Compound Name | methyl 5-[(2R)-2-(4-chlorophenyl)morpholine-4-carbonyl]-1-methylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 95217867 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | methyl 5-[(2R)-2-(4-chlorophenyl)morpholine-4-carbonyl]-1-methylpyrazole-3-carboxylate |
| SMILES | COC(=O)c1cc(C(=O)N2CCO[C@H](c3ccc(Cl)cc3)C2)n(C)n1 |
| InChI | InChI=1S/C17H18ClN3O4/c1-20-14(9-13(19-20)17(23)24-2)16(22)21-7-8-25-15(10-21)11-3-5-12(18)6-4-11/h3-6,9,15H,7-8,10H2,1-2H3/t15-/m0/s1 |
| InChIKey | NALFRPMMZQNIRP-HNNXBMFYSA-N |
| XLogP | 2.07 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |