C16H21N3O3 — CID 124609246
(1-tert-butylpyrazol-4-yl)-[(2S)-2-(furan-2-yl)morpholin-4-yl]methanone (PubChem CID 124609246) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is (1-tert-butylpyrazol-4-yl)-[(2S)-2-(furan-2-yl)morpholin-4-yl]methanone.
| Compound Name | (1-tert-butylpyrazol-4-yl)-[(2S)-2-(furan-2-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 124609246 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (1-tert-butylpyrazol-4-yl)-[(2S)-2-(furan-2-yl)morpholin-4-yl]methanone |
| SMILES | CC(C)(C)n1cc(C(=O)N2CCO[C@H](c3ccco3)C2)cn1 |
| InChI | InChI=1S/C16H21N3O3/c1-16(2,3)19-10-12(9-17-19)15(20)18-6-8-22-14(11-18)13-5-4-7-21-13/h4-5,7,9-10,14H,6,8,11H2,1-3H3/t14-/m0/s1 |
| InChIKey | ZFWIFATXSZCWKL-AWEZNQCLSA-N |
| XLogP | 2.44 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |