C16H17ClN4O3 — CID 95156596
N'-(3-chloro-4-pyrazol-1-ylphenyl)-N-[[(2R)-oxolan-2-yl]methyl]oxamide (PubChem CID 95156596) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is N'-(3-chloro-4-pyrazol-1-ylphenyl)-N-[[(2R)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-(3-chloro-4-pyrazol-1-ylphenyl)-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 95156596 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N'-(3-chloro-4-pyrazol-1-ylphenyl)-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
| SMILES | O=C(NC[C@H]1CCCO1)C(=O)Nc1ccc(-n2cccn2)c(Cl)c1 |
| InChI | InChI=1S/C16H17ClN4O3/c17-13-9-11(4-5-14(13)21-7-2-6-19-21)20-16(23)15(22)18-10-12-3-1-8-24-12/h2,4-7,9,12H,1,3,8,10H2,(H,18,22)(H,20,23)/t12-/m1/s1 |
| InChIKey | LYUVAUXQQQEXJG-GFCCVEGCSA-N |
| XLogP | 1.76 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|