C15H17FN4O2 — CID 95615000
1-(5-fluoro-2-pyrazol-1-ylphenyl)-3-[[(2S)-oxolan-2-yl]methyl]urea (PubChem CID 95615000) has the molecular formula C15H17FN4O2 and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyrazol-1-ylphenyl)-3-[[(2S)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-(5-fluoro-2-pyrazol-1-ylphenyl)-3-[[(2S)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 95615000 |
| Molecular Formula | C15H17FN4O2 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 1-(5-fluoro-2-pyrazol-1-ylphenyl)-3-[[(2S)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(NC[C@@H]1CCCO1)Nc1cc(F)ccc1-n1cccn1 |
| InChI | InChI=1S/C15H17FN4O2/c16-11-4-5-14(20-7-2-6-18-20)13(9-11)19-15(21)17-10-12-3-1-8-22-12/h2,4-7,9,12H,1,3,8,10H2,(H2,17,19,21)/t12-/m0/s1 |
| InChIKey | DVOUXNLLHKSKMA-LBPRGKRZSA-N |
| XLogP | 2.31 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |