C16H19FN4O2 — CID 111107523
1-(5-fluoro-2-pyrazol-1-ylphenyl)-3-(2-hydroxycyclohexyl)urea (PubChem CID 111107523) has the molecular formula C16H19FN4O2 and a molecular weight of 318.35 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyrazol-1-ylphenyl)-3-(2-hydroxycyclohexyl)urea.
| Compound Name | 1-(5-fluoro-2-pyrazol-1-ylphenyl)-3-(2-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 111107523 |
| Molecular Formula | C16H19FN4O2 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1-(5-fluoro-2-pyrazol-1-ylphenyl)-3-(2-hydroxycyclohexyl)urea |
| SMILES | O=C(Nc1cc(F)ccc1-n1cccn1)NC1CCCCC1O |
| InChI | InChI=1S/C16H19FN4O2/c17-11-6-7-14(21-9-3-8-18-21)13(10-11)20-16(23)19-12-4-1-2-5-15(12)22/h3,6-10,12,15,22H,1-2,4-5H2,(H2,19,20,23) |
| InChIKey | KPXDAGQREVIYJT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |