C18H24N4O2 — CID 124777004
1-[(1S,2R)-2-hydroxycyclohexyl]-3-[(1S)-1-(2-pyrazol-1-ylphenyl)ethyl]urea (PubChem CID 124777004) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-[(1S,2R)-2-hydroxycyclohexyl]-3-[(1S)-1-(2-pyrazol-1-ylphenyl)ethyl]urea.
| Compound Name | 1-[(1S,2R)-2-hydroxycyclohexyl]-3-[(1S)-1-(2-pyrazol-1-ylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 124777004 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1-[(1S,2R)-2-hydroxycyclohexyl]-3-[(1S)-1-(2-pyrazol-1-ylphenyl)ethyl]urea |
| SMILES | C[C@H](NC(=O)N[C@H]1CCCC[C@H]1O)c1ccccc1-n1cccn1 |
| InChI | InChI=1S/C18H24N4O2/c1-13(20-18(24)21-15-8-3-5-10-17(15)23)14-7-2-4-9-16(14)22-12-6-11-19-22/h2,4,6-7,9,11-13,15,17,23H,3,5,8,10H2,1H3,(H2,20,21,24)/t13-,15-,17+/m0/s1 |
| InChIKey | GMZTUCJZDNLHOR-JLJPHGGASA-N |
| XLogP | 2.54 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |