C16H19N3O4 — CID 124603422
(2R)-N-(2-methoxy-3-pyridinyl)-2-(5-methylfuran-2-yl)morpholine-4-carboxamide (PubChem CID 124603422) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is (2R)-N-(2-methoxy-3-pyridinyl)-2-(5-methylfuran-2-yl)morpholine-4-carboxamide.
| Compound Name | (2R)-N-(2-methoxy-3-pyridinyl)-2-(5-methylfuran-2-yl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 124603422 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (2R)-N-(2-methoxy-3-pyridinyl)-2-(5-methylfuran-2-yl)morpholine-4-carboxamide |
| SMILES | COc1ncccc1NC(=O)N1CCO[C@@H](c2ccc(C)o2)C1 |
| InChI | InChI=1S/C16H19N3O4/c1-11-5-6-13(23-11)14-10-19(8-9-22-14)16(20)18-12-4-3-7-17-15(12)21-2/h3-7,14H,8-10H2,1-2H3,(H,18,20)/t14-/m1/s1 |
| InChIKey | VTWDUGKJJGRKOR-CQSZACIVSA-N |
| XLogP | 2.60 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |