C18H30N2O4 — CID 109398792
N-[2-(2-hydroxyethyl)-4-methylpentyl]-2-(5-methylfuran-2-yl)morpholine-4-carboxamide (PubChem CID 109398792) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[2-(2-hydroxyethyl)-4-methylpentyl]-2-(5-methylfuran-2-yl)morpholine-4-carboxamide.
| Compound Name | N-[2-(2-hydroxyethyl)-4-methylpentyl]-2-(5-methylfuran-2-yl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 109398792 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | N-[2-(2-hydroxyethyl)-4-methylpentyl]-2-(5-methylfuran-2-yl)morpholine-4-carboxamide |
| SMILES | Cc1ccc(C2CN(C(=O)NCC(CCO)CC(C)C)CCO2)o1 |
| InChI | InChI=1S/C18H30N2O4/c1-13(2)10-15(6-8-21)11-19-18(22)20-7-9-23-17(12-20)16-5-4-14(3)24-16/h4-5,13,15,17,21H,6-12H2,1-3H3,(H,19,22) |
| InChIKey | LKWPZKVBSSCCPT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |