C18H16F5NO3S — CID 133449960
4-[2-(difluoromethylsulfonyl)phenyl]-2-[4-(trifluoromethyl)phenyl]morpholine (PubChem CID 133449960) has the molecular formula C18H16F5NO3S and a molecular weight of 421.39 g/mol. Its IUPAC name is 4-[2-(difluoromethylsulfonyl)phenyl]-2-[4-(trifluoromethyl)phenyl]morpholine.
| Compound Name | 4-[2-(difluoromethylsulfonyl)phenyl]-2-[4-(trifluoromethyl)phenyl]morpholine |
|---|---|
| PubChem CID | 133449960 |
| Molecular Formula | C18H16F5NO3S |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 4-[2-(difluoromethylsulfonyl)phenyl]-2-[4-(trifluoromethyl)phenyl]morpholine |
| SMILES | O=S(=O)(c1ccccc1N1CCOC(c2ccc(C(F)(F)F)cc2)C1)C(F)F |
| InChI | InChI=1S/C18H16F5NO3S/c19-17(20)28(25,26)16-4-2-1-3-14(16)24-9-10-27-15(11-24)12-5-7-13(8-6-12)18(21,22)23/h1-8,15,17H,9-11H2 |
| InChIKey | UQMHBSRCGAVULR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |