C20H23F3N2O3S — CID 133449768
4-(6-tert-butylsulfonyl-3-pyridinyl)-2-[4-(trifluoromethyl)phenyl]morpholine (PubChem CID 133449768) has the molecular formula C20H23F3N2O3S and a molecular weight of 428.48 g/mol. Its IUPAC name is 4-(6-tert-butylsulfonyl-3-pyridinyl)-2-[4-(trifluoromethyl)phenyl]morpholine.
| Compound Name | 4-(6-tert-butylsulfonyl-3-pyridinyl)-2-[4-(trifluoromethyl)phenyl]morpholine |
|---|---|
| PubChem CID | 133449768 |
| Molecular Formula | C20H23F3N2O3S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 4-(6-tert-butylsulfonyl-3-pyridinyl)-2-[4-(trifluoromethyl)phenyl]morpholine |
| SMILES | CC(C)(C)S(=O)(=O)c1ccc(N2CCOC(c3ccc(C(F)(F)F)cc3)C2)cn1 |
| InChI | InChI=1S/C20H23F3N2O3S/c1-19(2,3)29(26,27)18-9-8-16(12-24-18)25-10-11-28-17(13-25)14-4-6-15(7-5-14)20(21,22)23/h4-9,12,17H,10-11,13H2,1-3H3 |
| InChIKey | IREOFNKJWJSEDJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |