C19H22F3N3O — CID 133449908
4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine (PubChem CID 133449908) has the molecular formula C19H22F3N3O and a molecular weight of 365.40 g/mol. Its IUPAC name is 4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine.
| Compound Name | 4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine |
|---|---|
| PubChem CID | 133449908 |
| Molecular Formula | C19H22F3N3O |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine |
| SMILES | Cc1cc(N2CCOC(c3ccc(C(F)(F)F)cc3)C2)nc(C(C)C)n1 |
| InChI | InChI=1S/C19H22F3N3O/c1-12(2)18-23-13(3)10-17(24-18)25-8-9-26-16(11-25)14-4-6-15(7-5-14)19(20,21)22/h4-7,10,12,16H,8-9,11H2,1-3H3 |
| InChIKey | ZXOXAWDUFAKMED-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |