C17H13ClF3N3O — CID 133449777
5-chloro-6-[2-[4-(trifluoromethyl)phenyl]morpholin-4-yl]pyridine-3-carbonitrile (PubChem CID 133449777) has the molecular formula C17H13ClF3N3O and a molecular weight of 367.76 g/mol. Its IUPAC name is 5-chloro-6-[2-[4-(trifluoromethyl)phenyl]morpholin-4-yl]pyridine-3-carbonitrile.
| Compound Name | 5-chloro-6-[2-[4-(trifluoromethyl)phenyl]morpholin-4-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133449777 |
| Molecular Formula | C17H13ClF3N3O |
| Molecular Weight | 367.76 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 5-chloro-6-[2-[4-(trifluoromethyl)phenyl]morpholin-4-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(N2CCOC(c3ccc(C(F)(F)F)cc3)C2)c(Cl)c1 |
| InChI | InChI=1S/C17H13ClF3N3O/c18-14-7-11(8-22)9-23-16(14)24-5-6-25-15(10-24)12-1-3-13(4-2-12)17(19,20)21/h1-4,7,9,15H,5-6,10H2 |
| InChIKey | HQJIRXXPJANKPH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.76 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |