C15H12ClF3N6 — CID 139027073
5-chloro-6-[4-[6-(trifluoromethyl)pyridazin-3-yl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 139027073) has the molecular formula C15H12ClF3N6 and a molecular weight of 368.75 g/mol. Its IUPAC name is 5-chloro-6-[4-[6-(trifluoromethyl)pyridazin-3-yl]piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 5-chloro-6-[4-[6-(trifluoromethyl)pyridazin-3-yl]piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 139027073 |
| Molecular Formula | C15H12ClF3N6 |
| Molecular Weight | 368.75 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 5-chloro-6-[4-[6-(trifluoromethyl)pyridazin-3-yl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(N2CCN(c3ccc(C(F)(F)F)nn3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C15H12ClF3N6/c16-11-7-10(8-20)9-21-14(11)25-5-3-24(4-6-25)13-2-1-12(22-23-13)15(17,18)19/h1-2,7,9H,3-6H2 |
| InChIKey | VCOKNGRIWJHIQV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 68.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.75 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |