C13H18N2O2 — CID 78941118
1-[4-[(1R)-1-hydroxyethyl]phenyl]-1,4-diazepan-5-one (PubChem CID 78941118) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-[4-[(1R)-1-hydroxyethyl]phenyl]-1,4-diazepan-5-one.
| Compound Name | 1-[4-[(1R)-1-hydroxyethyl]phenyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 78941118 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-[4-[(1R)-1-hydroxyethyl]phenyl]-1,4-diazepan-5-one |
| SMILES | C[C@@H](O)c1ccc(N2CCNC(=O)CC2)cc1 |
| InChI | InChI=1S/C13H18N2O2/c1-10(16)11-2-4-12(5-3-11)15-8-6-13(17)14-7-9-15/h2-5,10,16H,6-9H2,1H3,(H,14,17)/t10-/m1/s1 |
| InChIKey | BJOMLRRZHZGFJF-SNVBAGLBSA-N |
| XLogP | 1.07 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|