C12H18N4O — CID 83127452
1-[6-(1-aminoethyl)-3-pyridinyl]-1,4-diazepan-5-one (PubChem CID 83127452) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-[6-(1-aminoethyl)-3-pyridinyl]-1,4-diazepan-5-one.
| Compound Name | 1-[6-(1-aminoethyl)-3-pyridinyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 83127452 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 1-[6-(1-aminoethyl)-3-pyridinyl]-1,4-diazepan-5-one |
| SMILES | CC(N)c1ccc(N2CCNC(=O)CC2)cn1 |
| InChI | InChI=1S/C12H18N4O/c1-9(13)11-3-2-10(8-15-11)16-6-4-12(17)14-5-7-16/h2-3,8-9H,4-7,13H2,1H3,(H,14,17) |
| InChIKey | MTLZWQIZHHIJQB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |