C12H13ClN2S — CID 117129093
6-chloro-2-(thiolan-3-ylmethyl)imidazo[1,2-a]pyridine (PubChem CID 117129093) has the molecular formula C12H13ClN2S and a molecular weight of 252.77 g/mol. Its IUPAC name is 6-chloro-2-(thiolan-3-ylmethyl)imidazo[1,2-a]pyridine.
| Compound Name | 6-chloro-2-(thiolan-3-ylmethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117129093 |
| Molecular Formula | C12H13ClN2S |
| Molecular Weight | 252.77 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 6-chloro-2-(thiolan-3-ylmethyl)imidazo[1,2-a]pyridine |
| SMILES | Clc1ccc2nc(CC3CCSC3)cn2c1 |
| InChI | InChI=1S/C12H13ClN2S/c13-10-1-2-12-14-11(7-15(12)6-10)5-9-3-4-16-8-9/h1-2,6-7,9H,3-5,8H2 |
| InChIKey | PNNYTOHAPPAPAP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.77 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |