C12H13ClN2O — CID 117129074
6-chloro-2-(oxolan-3-ylmethyl)imidazo[1,2-a]pyridine (PubChem CID 117129074) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 6-chloro-2-(oxolan-3-ylmethyl)imidazo[1,2-a]pyridine.
| Compound Name | 6-chloro-2-(oxolan-3-ylmethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117129074 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 6-chloro-2-(oxolan-3-ylmethyl)imidazo[1,2-a]pyridine |
| SMILES | Clc1ccc2nc(CC3CCOC3)cn2c1 |
| InChI | InChI=1S/C12H13ClN2O/c13-10-1-2-12-14-11(7-15(12)6-10)5-9-3-4-16-8-9/h1-2,6-7,9H,3-5,8H2 |
| InChIKey | LLXRDDKAEWHFLX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |