C13H14N2O2 — CID 117133746
2-(oxolan-3-ylmethyl)imidazo[1,2-a]pyridine-7-carbaldehyde (PubChem CID 117133746) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-(oxolan-3-ylmethyl)imidazo[1,2-a]pyridine-7-carbaldehyde.
| Compound Name | 2-(oxolan-3-ylmethyl)imidazo[1,2-a]pyridine-7-carbaldehyde |
|---|---|
| PubChem CID | 117133746 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-(oxolan-3-ylmethyl)imidazo[1,2-a]pyridine-7-carbaldehyde |
| SMILES | O=Cc1ccn2cc(CC3CCOC3)nc2c1 |
| InChI | InChI=1S/C13H14N2O2/c16-8-10-1-3-15-7-12(14-13(15)6-10)5-11-2-4-17-9-11/h1,3,6-8,11H,2,4-5,9H2 |
| InChIKey | YSVWUCVMLFQAFX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|