About 2-(7-methylimidazo[1,2-a]pyridin-2-yl)acetonitrile
2-(7-methylimidazo[1,2-a]pyridin-2-yl)acetonitrile (PubChem CID 82055270) has the molecular formula C10H9N3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-(7-methylimidazo[1,2-a]pyridin-2-yl)acetonitrile.
Analyze 2-(7-methylimidazo[1,2-a]pyridin-2-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-methylimidazo[1,2-a]pyridin-2-yl)acetonitrile?
The IUPAC name of 2-(7-methylimidazo[1,2-a]pyridin-2-yl)acetonitrile (CID 82055270) is 2-(7-methylimidazo[1,2-a]pyridin-2-yl)acetonitrile.
What is the SMILES notation for 2-(7-methylimidazo[1,2-a]pyridin-2-yl)acetonitrile?
The canonical SMILES for 2-(7-methylimidazo[1,2-a]pyridin-2-yl)acetonitrile is Cc1ccn2cc(CC#N)nc2c1.
What is the InChIKey of 2-(7-methylimidazo[1,2-a]pyridin-2-yl)acetonitrile?
The InChIKey is YEMSARVTGJRZGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3/c1-8-3-5-13-7-9(2-4-11)12-10(13)6-8/h3,5-7H,2H2,1H3.
What are the key properties of 2-(7-methylimidazo[1,2-a]pyridin-2-yl)acetonitrile?
2-(7-methylimidazo[1,2-a]pyridin-2-yl)acetonitrile has a molecular weight of 171.20 g/mol, XLogP of 1.71, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-methylimidazo[1,2-a]pyridin-2-yl)acetonitrile is sourced from PubChem (CID 82055270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).