C15H13FN2 — CID 117134964
2-[(3-fluorophenyl)methyl]-7-methylimidazo[1,2-a]pyridine (PubChem CID 117134964) has the molecular formula C15H13FN2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-7-methylimidazo[1,2-a]pyridine.
| Compound Name | 2-[(3-fluorophenyl)methyl]-7-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117134964 |
| Molecular Formula | C15H13FN2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-7-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1ccn2cc(Cc3cccc(F)c3)nc2c1 |
| InChI | InChI=1S/C15H13FN2/c1-11-5-6-18-10-14(17-15(18)7-11)9-12-3-2-4-13(16)8-12/h2-8,10H,9H2,1H3 |
| InChIKey | BDGZPHJMTYQSDR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |