C15H14N2O — CID 117135218
4-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]phenol (PubChem CID 117135218) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]phenol.
| Compound Name | 4-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]phenol |
|---|---|
| PubChem CID | 117135218 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 4-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]phenol |
| SMILES | Cc1ccn2cc(Cc3ccc(O)cc3)nc2c1 |
| InChI | InChI=1S/C15H14N2O/c1-11-6-7-17-10-13(16-15(17)8-11)9-12-2-4-14(18)5-3-12/h2-8,10,18H,9H2,1H3 |
| InChIKey | XIORTSOGQMXYLO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |