C22H21ClO5 — CID 149119945
methyl 3-[4-[(6-chloro-2,3-dihydro-1,4-benzodioxin-3-yl)methoxy]phenyl]hex-4-ynoate (PubChem CID 149119945) has the molecular formula C22H21ClO5 and a molecular weight of 400.86 g/mol. Its IUPAC name is methyl 3-[4-[(6-chloro-2,3-dihydro-1,4-benzodioxin-3-yl)methoxy]phenyl]hex-4-ynoate.
| Compound Name | methyl 3-[4-[(6-chloro-2,3-dihydro-1,4-benzodioxin-3-yl)methoxy]phenyl]hex-4-ynoate |
|---|---|
| PubChem CID | 149119945 |
| Molecular Formula | C22H21ClO5 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | methyl 3-[4-[(6-chloro-2,3-dihydro-1,4-benzodioxin-3-yl)methoxy]phenyl]hex-4-ynoate |
| SMILES | CC#CC(CC(=O)OC)c1ccc(OCC2COc3ccc(Cl)cc3O2)cc1 |
| InChI | InChI=1S/C22H21ClO5/c1-3-4-16(11-22(24)25-2)15-5-8-18(9-6-15)26-13-19-14-27-20-10-7-17(23)12-21(20)28-19/h5-10,12,16,19H,11,13-14H2,1-2H3 |
| InChIKey | QZHVNNMHTVSFJM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|