C20H19ClO4 — CID 140573504
3-[4-[1-(3-chlorophenoxy)ethoxy]phenyl]hex-4-ynoic acid (PubChem CID 140573504) has the molecular formula C20H19ClO4 and a molecular weight of 358.82 g/mol. Its IUPAC name is 3-[4-[1-(3-chlorophenoxy)ethoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[1-(3-chlorophenoxy)ethoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 140573504 |
| Molecular Formula | C20H19ClO4 |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-[4-[1-(3-chlorophenoxy)ethoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OC(C)Oc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H19ClO4/c1-3-5-16(12-20(22)23)15-8-10-18(11-9-15)24-14(2)25-19-7-4-6-17(21)13-19/h4,6-11,13-14,16H,12H2,1-2H3,(H,22,23) |
| InChIKey | YLPLCPBCYOUKEG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|