C22H28O2 — CID 141322110
1-tert-butyl-3-[[1-(phenoxymethyl)cyclobutyl]methoxy]benzene (PubChem CID 141322110) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is 1-tert-butyl-3-[[1-(phenoxymethyl)cyclobutyl]methoxy]benzene.
| Compound Name | 1-tert-butyl-3-[[1-(phenoxymethyl)cyclobutyl]methoxy]benzene |
|---|---|
| PubChem CID | 141322110 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 1-tert-butyl-3-[[1-(phenoxymethyl)cyclobutyl]methoxy]benzene |
| SMILES | CC(C)(C)c1cccc(OCC2(COc3ccccc3)CCC2)c1 |
| InChI | InChI=1S/C22H28O2/c1-21(2,3)18-9-7-12-20(15-18)24-17-22(13-8-14-22)16-23-19-10-5-4-6-11-19/h4-7,9-12,15H,8,13-14,16-17H2,1-3H3 |
| InChIKey | UUHXVOAZQOYDNL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |