C20H26O5 — CID 139304271
dimethyl 2-[(1S)-1-[4-(2,2-dimethylpropoxy)phenyl]but-2-ynyl]propanedioate (PubChem CID 139304271) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is dimethyl 2-[(1S)-1-[4-(2,2-dimethylpropoxy)phenyl]but-2-ynyl]propanedioate.
| Compound Name | dimethyl 2-[(1S)-1-[4-(2,2-dimethylpropoxy)phenyl]but-2-ynyl]propanedioate |
|---|---|
| PubChem CID | 139304271 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | dimethyl 2-[(1S)-1-[4-(2,2-dimethylpropoxy)phenyl]but-2-ynyl]propanedioate |
| SMILES | CC#C[C@H](c1ccc(OCC(C)(C)C)cc1)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C20H26O5/c1-7-8-16(17(18(21)23-5)19(22)24-6)14-9-11-15(12-10-14)25-13-20(2,3)4/h9-12,16-17H,13H2,1-6H3/t16-/m1/s1 |
| InChIKey | WQNXZGRYKQCDKM-MRXNPFEDSA-N |
| XLogP | 3.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|