C38H38N2O3 — CID 58230602
3-[4-[[4-[(1-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 58230602) has the molecular formula C38H38N2O3 and a molecular weight of 570.73 g/mol. Its IUPAC name is 3-[4-[[4-[(1-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[4-[(1-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 58230602 |
| Molecular Formula | C38H38N2O3 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | 3-[4-[[4-[(1-phenylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCc2ccc(CN3CCC4(CC3)CN(c3ccccc3)c3ccccc34)cc2)cc1 |
| InChI | InChI=1S/C38H38N2O3/c1-2-8-32(25-37(41)42)31-17-19-34(20-18-31)43-27-30-15-13-29(14-16-30)26-39-23-21-38(22-24-39)28-40(33-9-4-3-5-10-33)36-12-7-6-11-35(36)38/h3-7,9-20,32H,21-28H2,1H3,(H,41,42) |
| InChIKey | YPPVVNXEJUDPRL-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|