C31H36N4O3 — CID 118675531
3-[4-[[4-[[4-(5-propylpyrimidin-2-yl)piperazin-1-yl]methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 118675531) has the molecular formula C31H36N4O3 and a molecular weight of 512.65 g/mol. Its IUPAC name is 3-[4-[[4-[[4-(5-propylpyrimidin-2-yl)piperazin-1-yl]methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[4-[[4-(5-propylpyrimidin-2-yl)piperazin-1-yl]methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 118675531 |
| Molecular Formula | C31H36N4O3 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 3-[4-[[4-[[4-(5-propylpyrimidin-2-yl)piperazin-1-yl]methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCc2ccc(CN3CCN(c4ncc(CCC)cn4)CC3)cc2)cc1 |
| InChI | InChI=1S/C31H36N4O3/c1-3-5-26-20-32-31(33-21-26)35-17-15-34(16-18-35)22-24-7-9-25(10-8-24)23-38-29-13-11-27(12-14-29)28(6-4-2)19-30(36)37/h7-14,20-21,28H,3,5,15-19,22-23H2,1-2H3,(H,36,37) |
| InChIKey | SXAJQBDGIGRZQP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|