C33H32INO3 — CID 155257398
iodo (3S)-3-[4-[[4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate (PubChem CID 155257398) has the molecular formula C33H32INO3 and a molecular weight of 617.53 g/mol. Its IUPAC name is iodo (3S)-3-[4-[[4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate.
| Compound Name | iodo (3S)-3-[4-[[4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate |
|---|---|
| PubChem CID | 155257398 |
| Molecular Formula | C33H32INO3 |
| Molecular Weight | 617.53 g/mol |
| Exact Mass | 617.14 |
| IUPAC Name | iodo (3S)-3-[4-[[4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate |
| SMILES | CC#C[C@@H](CC(=O)OI)c1ccc(OCc2ccc(CN3CCC4(C=Cc5ccccc54)CC3)cc2)cc1 |
| InChI | InChI=1S/C33H32INO3/c1-2-5-29(22-32(36)38-34)27-12-14-30(15-13-27)37-24-26-10-8-25(9-11-26)23-35-20-18-33(19-21-35)17-16-28-6-3-4-7-31(28)33/h3-4,6-17,29H,18-24H2,1H3/t29-/m0/s1 |
| InChIKey | MWIDTCKQEHXTCW-LJAQVGFWSA-N |
| XLogP | 7.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.53 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|