C15H8BrCl3N2O2 — CID 1348510
N-[2-(3-bromophenyl)-1,3-benzoxazol-5-yl]-2,2,2-trichloroacetamide (PubChem CID 1348510) has the molecular formula C15H8BrCl3N2O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is N-[2-(3-bromophenyl)-1,3-benzoxazol-5-yl]-2,2,2-trichloroacetamide.
| Compound Name | N-[2-(3-bromophenyl)-1,3-benzoxazol-5-yl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 1348510 |
| Molecular Formula | C15H8BrCl3N2O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 431.88 |
| IUPAC Name | N-[2-(3-bromophenyl)-1,3-benzoxazol-5-yl]-2,2,2-trichloroacetamide |
| SMILES | O=C(Nc1ccc2oc(-c3cccc(Br)c3)nc2c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H8BrCl3N2O2/c16-9-3-1-2-8(6-9)13-21-11-7-10(4-5-12(11)23-13)20-14(22)15(17,18)19/h1-7H,(H,20,22) |
| InChIKey | JSTSGXOZFSSVBJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|