C17H13Cl3N2O2 — CID 5241503
2,2,2-trichloro-N-[2-(3,4-dimethylphenyl)-1,3-benzoxazol-5-yl]acetamide (PubChem CID 5241503) has the molecular formula C17H13Cl3N2O2 and a molecular weight of 383.66 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[2-(3,4-dimethylphenyl)-1,3-benzoxazol-5-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[2-(3,4-dimethylphenyl)-1,3-benzoxazol-5-yl]acetamide |
|---|---|
| PubChem CID | 5241503 |
| Molecular Formula | C17H13Cl3N2O2 |
| Molecular Weight | 383.66 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 2,2,2-trichloro-N-[2-(3,4-dimethylphenyl)-1,3-benzoxazol-5-yl]acetamide |
| SMILES | Cc1ccc(-c2nc3cc(NC(=O)C(Cl)(Cl)Cl)ccc3o2)cc1C |
| InChI | InChI=1S/C17H13Cl3N2O2/c1-9-3-4-11(7-10(9)2)15-22-13-8-12(5-6-14(13)24-15)21-16(23)17(18,19)20/h3-8H,1-2H3,(H,21,23) |
| InChIKey | NGZLNTDSKBVVFB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.66 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|