C20H17NO6 — CID 91681380
prop-2-ynyl 2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazole-5-carboxylate (PubChem CID 91681380) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is prop-2-ynyl 2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazole-5-carboxylate.
| Compound Name | prop-2-ynyl 2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 91681380 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | prop-2-ynyl 2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazole-5-carboxylate |
| SMILES | C#CCOC(=O)c1ccc2oc(-c3cc(OC)c(OC)c(OC)c3)nc2c1 |
| InChI | InChI=1S/C20H17NO6/c1-5-8-26-20(22)12-6-7-15-14(9-12)21-19(27-15)13-10-16(23-2)18(25-4)17(11-13)24-3/h1,6-7,9-11H,8H2,2-4H3 |
| InChIKey | SNBQSABBMNIKPJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 80.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|