C14H5Cl4NO2 — CID 50849533
2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride (PubChem CID 50849533) has the molecular formula C14H5Cl4NO2 and a molecular weight of 361.01 g/mol. Its IUPAC name is 2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride.
| Compound Name | 2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 50849533 |
| Molecular Formula | C14H5Cl4NO2 |
| Molecular Weight | 361.01 g/mol |
| Exact Mass | 358.91 |
| IUPAC Name | 2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc2oc(-c3cc(Cl)cc(Cl)c3Cl)nc2c1 |
| InChI | InChI=1S/C14H5Cl4NO2/c15-7-4-8(12(17)9(16)5-7)14-19-10-3-6(13(18)20)1-2-11(10)21-14/h1-5H |
| InChIKey | IGIFDWDSVVKOFS-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.01 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|