2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride

C14H5Cl4NO2 — CID 50849533

IUPAC2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride
SMILESO=C(Cl)c1ccc2oc(-c3cc(Cl)cc(Cl)c3Cl)nc2c1
InChIInChI=1S/C14H5Cl4NO2/c15-7-4-8(12(17)9(16)5-7)14-19-10-3-6(13(18)20)1-2-11(10)21-14/h1-5H
InChIKeyIGIFDWDSVVKOFS-UHFFFAOYSA-N
MW361.01 g/mol
LogP5.83
Rot. Bonds2

About 2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride

2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride (PubChem CID 50849533) has the molecular formula C14H5Cl4NO2 and a molecular weight of 361.01 g/mol. Its IUPAC name is 2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride.

Molecular Properties

Compound Name2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride
PubChem CID50849533
Molecular FormulaC14H5Cl4NO2
Molecular Weight361.01 g/mol
Exact Mass358.91
IUPAC Name2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride
SMILESO=C(Cl)c1ccc2oc(-c3cc(Cl)cc(Cl)c3Cl)nc2c1
InChIInChI=1S/C14H5Cl4NO2/c15-7-4-8(12(17)9(16)5-7)14-19-10-3-6(13(18)20)1-2-11(10)21-14/h1-5H
InChIKeyIGIFDWDSVVKOFS-UHFFFAOYSA-N
XLogP5.83
TPSA43.10 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500361.01
LogP ≤ 55.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride?
The IUPAC name of 2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride (CID 50849533) is 2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride.
What is the SMILES notation for 2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride?
The canonical SMILES for 2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride is O=C(Cl)c1ccc2oc(-c3cc(Cl)cc(Cl)c3Cl)nc2c1.
What is the InChIKey of 2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride?
The InChIKey is IGIFDWDSVVKOFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H5Cl4NO2/c15-7-4-8(12(17)9(16)5-7)14-19-10-3-6(13(18)20)1-2-11(10)21-14/h1-5H.
What are the key properties of 2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride?
2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride has a molecular weight of 361.01 g/mol, XLogP of 5.83, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3,5-trichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride is sourced from PubChem (CID 50849533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).