C24H22N2O4 — CID 135843357
2-(2,4-dimethylphenoxy)-N-[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]acetamide (PubChem CID 135843357) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-(2,4-dimethylphenoxy)-N-[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]acetamide.
| Compound Name | 2-(2,4-dimethylphenoxy)-N-[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 135843357 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-(2,4-dimethylphenoxy)-N-[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]acetamide |
| SMILES | Cc1ccc(OCC(=O)Nc2ccc(O)c(-c3nc4cc(C)ccc4o3)c2)c(C)c1 |
| InChI | InChI=1S/C24H22N2O4/c1-14-4-8-21(16(3)10-14)29-13-23(28)25-17-6-7-20(27)18(12-17)24-26-19-11-15(2)5-9-22(19)30-24/h4-12,27H,13H2,1-3H3,(H,25,28) |
| InChIKey | URAWSYZJRANILG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|