C22H17N3O4S — CID 135801898
S-[[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamoylamino] 4-methylbenzenecarbothioate (PubChem CID 135801898) has the molecular formula C22H17N3O4S and a molecular weight of 419.46 g/mol. Its IUPAC name is S-[[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamoylamino] 4-methylbenzenecarbothioate.
| Compound Name | S-[[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamoylamino] 4-methylbenzenecarbothioate |
|---|---|
| PubChem CID | 135801898 |
| Molecular Formula | C22H17N3O4S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | S-[[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamoylamino] 4-methylbenzenecarbothioate |
| SMILES | Cc1ccc(C(=O)SNC(=O)Nc2ccc(O)c(-c3nc4ccccc4o3)c2)cc1 |
| InChI | InChI=1S/C22H17N3O4S/c1-13-6-8-14(9-7-13)21(27)30-25-22(28)23-15-10-11-18(26)16(12-15)20-24-17-4-2-3-5-19(17)29-20/h2-12,26H,1H3,(H2,23,25,28) |
| InChIKey | YKPZHDSEBDPMTQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|