C22H16ClN3O5S — CID 135801897
S-[[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamoylamino] 3-chloro-4-methoxybenzenecarbothioate (PubChem CID 135801897) has the molecular formula C22H16ClN3O5S and a molecular weight of 469.91 g/mol. Its IUPAC name is S-[[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamoylamino] 3-chloro-4-methoxybenzenecarbothioate.
| Compound Name | S-[[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamoylamino] 3-chloro-4-methoxybenzenecarbothioate |
|---|---|
| PubChem CID | 135801897 |
| Molecular Formula | C22H16ClN3O5S |
| Molecular Weight | 469.91 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | S-[[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamoylamino] 3-chloro-4-methoxybenzenecarbothioate |
| SMILES | COc1ccc(C(=O)SNC(=O)Nc2ccc(O)c(-c3nc4ccccc4o3)c2)cc1Cl |
| InChI | InChI=1S/C22H16ClN3O5S/c1-30-18-9-6-12(10-15(18)23)21(28)32-26-22(29)24-13-7-8-17(27)14(11-13)20-25-16-4-2-3-5-19(16)31-20/h2-11,27H,1H3,(H2,24,26,29) |
| InChIKey | NZZGRVGDPUOLBG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.91 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|